EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O6 |
| Net Charge | 0 |
| Average Mass | 296.319 |
| Monoisotopic Mass | 296.12599 |
| SMILES | CCC[C@H](O)C[C@@H]1Cc2cc(OC)c(O)c(O)c2C(=O)O1 |
| InChI | InChI=1S/C15H20O6/c1-3-4-9(16)7-10-5-8-6-11(20-2)13(17)14(18)12(8)15(19)21-10/h6,9-10,16-18H,3-5,7H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | YEQFHPAADMFAMI-UWVGGRQHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Colletotrichum (ncbitaxon:34409) | - | PubMed (21174408) | Crude ethylacetate extract of culture broth of endophytic fungus isolated from Piper ornatum Strain: CRI535 02 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fusarentin 6-methyl ether (CHEBI:70151) has role metabolite (CHEBI:25212) |
| Fusarentin 6-methyl ether (CHEBI:70151) is a hydroxybenzoic acid (CHEBI:24676) |
| Synonym | Source |
|---|---|
| (3S)-7,8-dihydroxy-3-[(2S)-2-hydroxypentyl]-6-methoxy-3,4-dihydroisochromen-1-one | ChEBI |
| Citations |
|---|