EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22O6 |
| Net Charge | 0 |
| Average Mass | 310.346 |
| Monoisotopic Mass | 310.14164 |
| SMILES | CCC[C@H](O)C[C@@H]1Cc2cc(OC)c(OC)c(O)c2C(=O)O1 |
| InChI | InChI=1S/C16H22O6/c1-4-5-10(17)8-11-6-9-7-12(20-2)15(21-3)14(18)13(9)16(19)22-11/h7,10-11,17-18H,4-6,8H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | QBCACQPIGRTBHJ-QWRGUYRKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Colletotrichum (ncbitaxon:34409) | - | PubMed (21174408) | Crude ethylacetate extract of culture broth of endophytic fungus isolated from Piper ornatum Strain: CRI535 02 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fusarentin 6,7-dimethyl ether (CHEBI:70150) has role metabolite (CHEBI:25212) |
| Fusarentin 6,7-dimethyl ether (CHEBI:70150) is a hydroxybenzoic acid (CHEBI:24676) |
| Synonym | Source |
|---|---|
| (3S)-8-hydroxy-3-[(2S)-2-hydroxypentyl]-6,7-dimethoxy-3,4-dihydroisochromen-1-one | ChEBI |
| Citations |
|---|