EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O5 |
| Net Charge | 0 |
| Average Mass | 302.326 |
| Monoisotopic Mass | 302.11542 |
| SMILES | COc1ccc([C@H]2COc3cc(O)ccc3C2)c(OC)c1O |
| InChI | InChI=1S/C17H18O5/c1-20-14-6-5-13(17(21-2)16(14)19)11-7-10-3-4-12(18)8-15(10)22-9-11/h3-6,8,11,18-19H,7,9H2,1-2H3/t11-/m1/s1 |
| InChIKey | NUNFZNIXYWTZMW-LLVKDONJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Robinia pseudoacacia (ncbitaxon:35938) | whole plant (BTO:0001461) | PubMed (21214467) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mucronulatol (CHEBI:7014) has functional parent (S)-isoflavan (CHEBI:36100) |
| mucronulatol (CHEBI:7014) has role antineoplastic agent (CHEBI:35610) |
| mucronulatol (CHEBI:7014) has role plant metabolite (CHEBI:76924) |
| mucronulatol (CHEBI:7014) is a hydroxyisoflavans (CHEBI:76250) |
| mucronulatol (CHEBI:7014) is a methoxyisoflavan (CHEBI:77002) |
| IUPAC Name |
|---|
| (3S)-3-(3-hydroxy-2,4-dimethoxyphenyl)-3,4-dihydro-2H-1-benzopyran-7-ol |
| Synonym | Source |
|---|---|
| (−)-mucronulatol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00002551 | KNApSAcK |
| C10507 | KEGG COMPOUND |
| LMPK12080024 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11296967 | Reaxys |
| CAS:20878-97-1 | KEGG COMPOUND |
| Citations |
|---|