EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H33NO5 |
| Net Charge | 0 |
| Average Mass | 415.530 |
| Monoisotopic Mass | 415.23587 |
| SMILES | [H][C@@]12CCCC(=C)[C@@]1(C)CC[C@H](C)[C@@]2(C)CC1=C(O)C(=O)C=C(NCCC(=O)O)C1=O |
| InChI | InChI=1S/C24H33NO5/c1-14-6-5-7-19-23(14,3)10-8-15(2)24(19,4)13-16-21(29)17(12-18(26)22(16)30)25-11-9-20(27)28/h12,15,19,25,30H,1,5-11,13H2,2-4H3,(H,27,28)/t15-,19+,23+,24+/m0/s1 |
| InChIKey | ADOWBZYFYUOPDL-ZZWUPXSGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dactylospongia elegans (ncbitaxon:1162779) | - | PubMed (21155589) | Methanolic extract of freeze-dried sponge material |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| smenospongines C (CHEBI:70137) has role animal metabolite (CHEBI:75767) |
| smenospongines C (CHEBI:70137) has role marine metabolite (CHEBI:76507) |
| smenospongines C (CHEBI:70137) is a enol (CHEBI:33823) |
| smenospongines C (CHEBI:70137) is a monocarboxylic acid (CHEBI:25384) |
| smenospongines C (CHEBI:70137) is a monohydroxy-1,4-benzoquinones (CHEBI:67273) |
| smenospongines C (CHEBI:70137) is a sesquiterpenoid (CHEBI:26658) |
| smenospongines C (CHEBI:70137) is a β-amino acid (CHEBI:33706) |
| IUPAC Name |
|---|
| N-(4-hydroxy-3,6-dioxo-5-{[(1R,2S,4aS,8aS)-1,2,4a-trimethyl-5-methylidenedecahydronaphthalen-1-yl]methyl}cyclohexa-1,4-dien-1-yl)-β-alanine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21223295 | Reaxys |
| Citations |
|---|