EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31NO5 |
| Net Charge | 0 |
| Average Mass | 401.503 |
| Monoisotopic Mass | 401.22022 |
| SMILES | [H][C@@]12CCCC(=C)[C@@]1(C)CC[C@H](C)[C@@]2(C)CC1=C(O)C(=O)C=C(NCC(=O)O)C1=O |
| InChI | InChI=1S/C23H31NO5/c1-13-6-5-7-18-22(13,3)9-8-14(2)23(18,4)11-15-20(28)16(24-12-19(26)27)10-17(25)21(15)29/h10,14,18,24,29H,1,5-9,11-12H2,2-4H3,(H,26,27)/t14-,18+,22+,23+/m0/s1 |
| InChIKey | NNDNTSLKXNJKMJ-LAHPKLRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dactylospongia elegans (ncbitaxon:1162779) | - | PubMed (21155589) | Methanolic extract of freeze-dried sponge material |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Smenospongines B (CHEBI:70136) has role metabolite (CHEBI:25212) |
| Smenospongines B (CHEBI:70136) is a monohydroxy-1,4-benzoquinones (CHEBI:67273) |
| Smenospongines B (CHEBI:70136) is a prenylquinone (CHEBI:26255) |
| Citations |
|---|