EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29NO3 |
| Net Charge | 0 |
| Average Mass | 355.478 |
| Monoisotopic Mass | 355.21474 |
| SMILES | [H][C@@]12CCCC(=C)[C@@]1(C)CC[C@H](C)[C@@]2(C)Cc1c(O)c(O)cc2ncoc12 |
| InChI | InChI=1S/C22H29NO3/c1-13-6-5-7-18-21(13,3)9-8-14(2)22(18,4)11-15-19(25)17(24)10-16-20(15)26-12-23-16/h10,12,14,18,24-25H,1,5-9,11H2,2-4H3/t14-,18+,21+,22+/m0/s1 |
| InChIKey | VRCMSDQYPBPHCD-YVUMSICPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dactylospongia elegans (ncbitaxon:1162779) | - | PubMed (21155589) | Methanolic extract of freeze-dried sponge material |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nakijinol B (CHEBI:70135) has role metabolite (CHEBI:25212) |
| Nakijinol B (CHEBI:70135) is a benzoxazole (CHEBI:46700) |
| Synonym | Source |
|---|---|
| 7-[[(1R,2S,4aS,8aS)-1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl]-1,3-benzoxazole-5,6-diol | ChEBI |
| Citations |
|---|