EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O4 |
| Net Charge | 0 |
| Average Mass | 358.478 |
| Monoisotopic Mass | 358.21441 |
| SMILES | [H][C@@]12CCCC(=C)[C@@]1(C)CC[C@H](C)[C@@]2(C)CC1=C(O)C(=O)C=C(OC)C1=O |
| InChI | InChI=1S/C22H30O4/c1-13-7-6-8-18-21(13,3)10-9-14(2)22(18,4)12-15-19(24)16(23)11-17(26-5)20(15)25/h11,14,18,24H,1,6-10,12H2,2-5H3/t14-,18+,21+,22+/m0/s1 |
| InChIKey | JJWITJNSXCXULM-YVUMSICPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dactylospongia elegans (ncbitaxon:1162779) | - | PubMed (21155589) | MeOH extract of freeze-dried sponge, isolated as 1:1 mixture of Ilimaquinone & 5-epi-ilimaquinone |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ilimaquinone (CHEBI:70133) has role metabolite (CHEBI:25212) |
| Ilimaquinone (CHEBI:70133) is a monohydroxy-1,4-benzoquinones (CHEBI:67273) |
| Ilimaquinone (CHEBI:70133) is a prenylquinone (CHEBI:26255) |
| Synonym | Source |
|---|---|
| 3-[[(1R,2S,4aS,8aS)-1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl]-2-hydroxy-5-methoxycyclohexa-2,5-diene-1,4-dione | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:71678-03-0 | ChemIDplus |
| Citations |
|---|