EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O5 |
| Net Charge | 0 |
| Average Mass | 328.364 |
| Monoisotopic Mass | 328.13107 |
| SMILES | COc1cc(O)c2cc(-c3cc(OC)c(C)c(OC)c3C)oc2c1 |
| InChI | InChI=1S/C19H20O5/c1-10-13(8-16(22-4)11(2)19(10)23-5)18-9-14-15(20)6-12(21-3)7-17(14)24-18/h6-9,20H,1-5H3 |
| InChIKey | YGZZMWPIMILKPS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stemona aphylla (ncbitaxon:492013) | root (BTO:0001188) | PubMed (21126060) | 95% Ethanolic extract of ground, dried roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Stemofuran R (CHEBI:70132) has role metabolite (CHEBI:25212) |
| Stemofuran R (CHEBI:70132) is a benzofurans (CHEBI:35259) |
| Synonym | Source |
|---|---|
| 2-(3,5-dimethoxy-2,4-dimethylphenyl)-6-methoxy-1-benzofuran-4-ol | ChEBI |
| Citations |
|---|