EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H50O2 |
| Net Charge | 0 |
| Average Mass | 454.739 |
| Monoisotopic Mass | 454.38108 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@]([H])([C@@H](C)C/C=C/C(C)(C)OC)CC[C@]3(C)C1=CC[C@@]1([H])C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C31H50O2/c1-21(11-10-17-27(2,3)33-9)22-14-19-31(8)24-12-13-25-28(4,5)26(32)16-18-29(25,6)23(24)15-20-30(22,31)7/h10,12,17,21-23,25H,11,13-16,18-20H2,1-9H3/b17-10+/t21-,22-,23-,25-,29+,30-,31+/m0/s1 |
| InChIKey | VUTMJNYAUWPTQA-ADMPYRPZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cornus walteri (ncbitaxon:16907) | stem (BTO:0001300) | PubMed (21182258) | Previous component: stem bark; 80% Methanolic extract of dried, chopped stems and stem bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-leucophyllone (CHEBI:70122) has role plant metabolite (CHEBI:76924) |
| (−)-leucophyllone (CHEBI:70122) is a cyclic terpene ketone (CHEBI:36130) |
| (−)-leucophyllone (CHEBI:70122) is a ether (CHEBI:25698) |
| (−)-leucophyllone (CHEBI:70122) is a tirucallane triterpenoid (CHEBI:83211) |
| IUPAC Name |
|---|
| (13α,14β,17α,20S,23E)-25-methoxylanosta-7,23-dien-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7392049 | Reaxys |
| Citations |
|---|