EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O2 |
| Net Charge | 0 |
| Average Mass | 438.696 |
| Monoisotopic Mass | 438.34978 |
| SMILES | [H][C@]1([C@]2([H])CC[C@]3(C)C4=CC[C@@]5([H])C(C)(C)C(=O)CC[C@]5(C)[C@@]4([H])CC[C@@]23C)CO[C@@]([H])(C=C(C)C)C1 |
| InChI | InChI=1S/C30H46O2/c1-19(2)16-21-17-20(18-32-21)22-10-14-30(7)24-8-9-25-27(3,4)26(31)12-13-28(25,5)23(24)11-15-29(22,30)6/h8,16,20-23,25H,9-15,17-18H2,1-7H3/t20-,21+,22+,23+,25+,28-,29+,30-/m1/s1 |
| InChIKey | WAGHSYJXJAHWPX-LLUYJYKPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cornus walteri (ncbitaxon:16907) | |||
| stem (BTO:0001300) | PubMed (21182258) | 80% Methanolic extract of dried, chopped stems and stem bark | |
| stem (BTO:0001300) | PubMed (21182258) | Previous component: stem bark; 80% Methanolic extract of dried, chopped stems and stem bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deoxyflindissone (CHEBI:70121) has role plant metabolite (CHEBI:76924) |
| deoxyflindissone (CHEBI:70121) is a cyclic terpene ketone (CHEBI:36130) |
| deoxyflindissone (CHEBI:70121) is a oxolanes (CHEBI:26912) |
| deoxyflindissone (CHEBI:70121) is a tirucallane triterpenoid (CHEBI:83211) |
| IUPAC Name |
|---|
| (13α,14β,17α,20S,23R)-21,23-epoxylanosta-7,24-dien-3-one |
| Synonym | Source |
|---|---|
| 21,23-epoxytirucalla-7,24-diene-3-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6745652 | Reaxys |
| Citations |
|---|