EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O2 |
| Net Charge | 0 |
| Average Mass | 442.728 |
| Monoisotopic Mass | 442.38108 |
| SMILES | [H][C@]12CC[C@]3(C)[C@](C)(CC[C@@]3([H])[C@@H](C)CCCC(C)C)[C@]1([H])CC=C1C(C)(C)C(=O)C[C@@H](O)[C@@]12C |
| InChI | InChI=1S/C30H50O2/c1-19(2)10-9-11-20(3)21-14-16-29(7)22-12-13-24-27(4,5)25(31)18-26(32)30(24,8)23(22)15-17-28(21,29)6/h13,19-23,26,32H,9-12,14-18H2,1-8H3/t20-,21-,22+,23-,26+,28-,29+,30+/m0/s1 |
| InChIKey | FEAAYJYTVFABGY-UHNHVWPPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cornus walteri (ncbitaxon:16907) | stem (BTO:0001300) | PubMed (21182258) | 80% Methanolic extract of dried, chopped stems and stem bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cornusalterin K (CHEBI:70119) has role plant metabolite (CHEBI:76924) |
| cornusalterin K (CHEBI:70119) is a 3-oxo-Δ5-steroid (CHEBI:47907) |
| cornusalterin K (CHEBI:70119) is a cyclic terpene ketone (CHEBI:36130) |
| cornusalterin K (CHEBI:70119) is a secondary alcohol (CHEBI:35681) |
| cornusalterin K (CHEBI:70119) is a tirucallane triterpenoid (CHEBI:83211) |
| IUPAC Name |
|---|
| (1β,13α,14β,17α,20S)-1-hydroxylanost-5-en-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21220908 | Reaxys |
| Citations |
|---|