EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H52O2 |
| Net Charge | 0 |
| Average Mass | 456.755 |
| Monoisotopic Mass | 456.39673 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@]([H])([C@@H](C)C[C@H](C=C(C)C)OC)CC[C@]3(C)C1=CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C31H52O2/c1-20(2)18-22(33-9)19-21(3)23-12-16-31(8)25-10-11-26-28(4,5)27(32)14-15-29(26,6)24(25)13-17-30(23,31)7/h10,18,21-24,26-27,32H,11-17,19H2,1-9H3/t21-,22-,23-,24-,26-,27-,29+,30-,31+/m0/s1 |
| InChIKey | CMYFKSGATOJENB-OKYHLYSZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cornus walteri (ncbitaxon:16907) | stem (BTO:0001300) | PubMed (21182258) | Previous component: stem bark; 80% Methanolic extract of dried, chopped stems and stem bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cornusalterin J (CHEBI:70118) has role plant metabolite (CHEBI:76924) |
| cornusalterin J (CHEBI:70118) is a ether (CHEBI:25698) |
| cornusalterin J (CHEBI:70118) is a secondary alcohol (CHEBI:35681) |
| cornusalterin J (CHEBI:70118) is a tirucallane triterpenoid (CHEBI:83211) |
| IUPAC Name |
|---|
| (3β,13α,14β,17α,20S,23R)-23-methoxylanosta-7,24-dien-3-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21220909 | Reaxys |
| Citations |
|---|