EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H48O2 |
| Net Charge | 0 |
| Average Mass | 452.723 |
| Monoisotopic Mass | 452.36543 |
| SMILES | [H][C@@]1([C@@H](C)C[C@@H](C=C(C)C)OC)CC[C@]2(C)C3=CC[C@@]4([H])C(C)(C)C(=O)CC[C@]4(C)C3=CC[C@@]12C |
| InChI | InChI=1S/C31H48O2/c1-20(2)18-22(33-9)19-21(3)23-12-16-31(8)25-10-11-26-28(4,5)27(32)14-15-29(26,6)24(25)13-17-30(23,31)7/h10,13,18,21-23,26H,11-12,14-17,19H2,1-9H3/t21-,22+,23-,26-,29+,30-,31+/m0/s1 |
| InChIKey | WISSQECJGFKWLU-OWVCEBFMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cornus walteri (ncbitaxon:16907) | stem (BTO:0001300) | PubMed (21182258) | 80% Methanolic extract of dried, chopped stems and stem bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cornusalterin I (CHEBI:70117) has role plant metabolite (CHEBI:76924) |
| cornusalterin I (CHEBI:70117) is a cyclic terpene ketone (CHEBI:36130) |
| cornusalterin I (CHEBI:70117) is a ether (CHEBI:25698) |
| cornusalterin I (CHEBI:70117) is a tirucallane triterpenoid (CHEBI:83211) |
| IUPAC Name |
|---|
| (13α,14β,17α,20S,23S)-23-methoxylanosta-7,9(11),24-trien-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21220898 | Reaxys |
| Citations |
|---|