EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O |
| Net Charge | 0 |
| Average Mass | 424.713 |
| Monoisotopic Mass | 424.37052 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@]([H])([C@@H](C)CCCC(C)C)CC[C@]3(C)C1=CC[C@@]1([H])C(C)(C)C(=O)C=C[C@]21C |
| InChI | InChI=1S/C30H48O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h12,16-17,20-23,25H,9-11,13-15,18-19H2,1-8H3/t21-,22-,23-,25-,28+,29-,30+/m0/s1 |
| InChIKey | ZYAWSDGOPQRREN-BWMIPAFUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cornus walteri (ncbitaxon:16907) | stem (BTO:0001300) | PubMed (21182258) | 80% Methanolic extract of dried, chopped stems and stem bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cornusalterin E (CHEBI:70113) has role plant metabolite (CHEBI:76924) |
| cornusalterin E (CHEBI:70113) is a cyclic terpene ketone (CHEBI:36130) |
| cornusalterin E (CHEBI:70113) is a tirucallane triterpenoid (CHEBI:83211) |
| IUPAC Name |
|---|
| (13α,14β,17α,20S)-lanosta-1,7-dien-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21220897 | Reaxys |
| Citations |
|---|