EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O |
| Net Charge | 0 |
| Average Mass | 422.697 |
| Monoisotopic Mass | 422.35487 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@]([H])([C@@H](C)C/C=C/C(=C)C)CC[C@]3(C)C1=CC[C@@]1([H])C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C30H46O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h9-10,12,21-23,25H,1,11,13-19H2,2-8H3/b10-9+/t21-,22-,23-,25-,28+,29-,30+/m0/s1 |
| InChIKey | SPMYJZJNYRWSFW-VSZZGVRKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cornus walteri (ncbitaxon:16907) | stem (BTO:0001300) | PubMed (21182258) | Previous component: stem bark; 80% Methanolic extract of dried, chopped stems and stem bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cornusalterin D (CHEBI:70112) has role plant metabolite (CHEBI:76924) |
| cornusalterin D (CHEBI:70112) is a cyclic terpene ketone (CHEBI:36130) |
| cornusalterin D (CHEBI:70112) is a tirucallane triterpenoid (CHEBI:83211) |
| IUPAC Name |
|---|
| (13α,14β,17α,20S,23E)-lanosta-7,23,25-trien-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21220901 | Reaxys |
| Citations |
|---|