EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NO5 |
| Net Charge | 0 |
| Average Mass | 343.379 |
| Monoisotopic Mass | 343.14197 |
| SMILES | COc1cc(/C=C/C(=O)NCCc2ccc(O)cc2)cc(OC)c1O |
| InChI | InChI=1S/C19H21NO5/c1-24-16-11-14(12-17(25-2)19(16)23)5-8-18(22)20-10-9-13-3-6-15(21)7-4-13/h3-8,11-12,21,23H,9-10H2,1-2H3,(H,20,22)/b8-5+ |
| InChIKey | IEDBNTAKVGBZEP-VMPITWQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper boehmeriifolium (ncbitaxon:130389) | whole plant (BTO:0001461) | PubMed (21158422) | Species also known as Piper boehmeriaefolium. |
| Corydalis racemosa (ncbitaxon:54431) | whole plant (BTO:0001461) | PubMed (32495600) | |
| Corydalis edulis (ncbitaxon:54428) | whole plant (BTO:0001461) | PubMed (29552819) | |
| Tetragonia tetragonoides (ncbitaxon:45318) | aerial part (BTO:0001658) | PubMed (30263405) | |
| Peperomia tetraphylla (ncbitaxon:126647) | - | PubMed (20450045) | |
| Achyranthes bidentata (ncbitaxon:384659) | - | DOI (10.3390/molecules29122840) | |
| Metternichia macrocalyx (IPNI:77334309-1) | - | PubMed (39619525) | |
| Porcelia macrocarpa (ncbitaxon:2873998) | - | DOI (10.1016/S0031-9422(97)00364-6) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-trans-sinapoyltyramine (CHEBI:70105) has functional parent trans-sinapic acid (CHEBI:15714) |
| N-trans-sinapoyltyramine (CHEBI:70105) has role plant metabolite (CHEBI:76924) |
| N-trans-sinapoyltyramine (CHEBI:70105) is a N-sinapoyltyramine (CHEBI:234327) |
| IUPAC Name |
|---|
| (2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide |
| Synonyms | Source |
|---|---|
| (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide | ChEBI |
| trans-N-sinapoyltyramine | ChEBI |
| N-(4-hydroxyphenethyl)-3,5-dimethoxy-4-hydroxy-trans-cinnamamide | ChEBI |
| UniProt Name | Source |
|---|---|
| N-[(E)-sinapoyl]tyramine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000661 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:200125-11-7 | ChEBI |
| Citations |
|---|