EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29NO3 |
| Net Charge | 0 |
| Average Mass | 355.478 |
| Monoisotopic Mass | 355.21474 |
| SMILES | CC(C)CNC(=O)/C=C/C=C/CC/C=C/CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H29NO3/c1-18(2)16-23-22(24)12-10-8-6-4-3-5-7-9-11-19-13-14-20-21(15-19)26-17-25-20/h5-8,10,12-15,18H,3-4,9,11,16-17H2,1-2H3,(H,23,24)/b7-5+,8-6+,12-10+ |
| InChIKey | ZDZNXCGHTVJGMU-YBSKXHOQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper boehmeriaefolium (ncbitaxon:130389) | whole plant (BTO:0001461) | PubMed (21158422) | Methanolic extract of air-dried, powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,4E,8E)-N-isobutyl-11-(3,4-methylenedioxyphenyl)undeca-2,4,8-trienamide (CHEBI:70104) has role metabolite (CHEBI:25212) |
| (2E,4E,8E)-N-isobutyl-11-(3,4-methylenedioxyphenyl)undeca-2,4,8-trienamide (CHEBI:70104) is a benzodioxoles (CHEBI:38298) |
| Citations |
|---|