EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29NO3 |
| Net Charge | 0 |
| Average Mass | 331.456 |
| Monoisotopic Mass | 331.21474 |
| SMILES | CC(C)CNC(=O)CCCCCC/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H29NO3/c1-16(2)14-21-20(22)10-8-6-4-3-5-7-9-17-11-12-18-19(13-17)24-15-23-18/h7,9,11-13,16H,3-6,8,10,14-15H2,1-2H3,(H,21,22)/b9-7+ |
| InChIKey | RIIYLNBWAREERF-VQHVLOKHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper boehmeriaefolium (ncbitaxon:130389) | whole plant (BTO:0001461) | PubMed (21158422) | Methanolic extract of air-dried, powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (8E)-N-isobutyl-9-(3,4-methylenedioxyphenyl)nona-8-enamide (CHEBI:70103) has role metabolite (CHEBI:25212) |
| (8E)-N-isobutyl-9-(3,4-methylenedioxyphenyl)nona-8-enamide (CHEBI:70103) is a benzodioxoles (CHEBI:38298) |
| Citations |
|---|