EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21NO3 |
| Net Charge | 0 |
| Average Mass | 299.370 |
| Monoisotopic Mass | 299.15214 |
| SMILES | O=C(/C=C/C=C/CCc1ccc2c(c1)OCO2)N1CCCC1 |
| InChI | InChI=1S/C18H21NO3/c20-18(19-11-5-6-12-19)8-4-2-1-3-7-15-9-10-16-17(13-15)22-14-21-16/h1-2,4,8-10,13H,3,5-7,11-12,14H2/b2-1+,8-4+ |
| InChIKey | IODPUHWFWZSHCM-AIWOWGKTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper boehmeriaefolium (ncbitaxon:130389) | whole plant (BTO:0001461) | PubMed (21158422) | Methanolic extract of air-dried, powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[(2E,4E)-7-(3,4-methylenedioxyphenyl)-2,4-heptadienoyl]pyrrolidine (CHEBI:70095) has role metabolite (CHEBI:25212) |
| 1-[(2E,4E)-7-(3,4-methylenedioxyphenyl)-2,4-heptadienoyl]pyrrolidine (CHEBI:70095) is a benzodioxoles (CHEBI:38298) |
| Citations |
|---|