EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29NO3 |
| Net Charge | 0 |
| Average Mass | 343.467 |
| Monoisotopic Mass | 343.21474 |
| SMILES | O=C(CCCCCCC/C=C/c1ccc2c(c1)OCO2)N1CCCC1 |
| InChI | InChI=1S/C21H29NO3/c23-21(22-14-8-9-15-22)11-7-5-3-1-2-4-6-10-18-12-13-19-20(16-18)25-17-24-19/h6,10,12-13,16H,1-5,7-9,11,14-15,17H2/b10-6+ |
| InChIKey | HRMXETZEKQCWBC-UXBLZVDNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper boehmeriaefolium (ncbitaxon:130389) | whole plant (BTO:0001461) | PubMed (21158422) | Methanolic extract of air-dried, powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[(9E)-10-(3,4-methylenedioxyphenyl)-9-decenoyl]pyrrolidine (CHEBI:70091) has role metabolite (CHEBI:25212) |
| 1-[(9E)-10-(3,4-methylenedioxyphenyl)-9-decenoyl]pyrrolidine (CHEBI:70091) is a benzodioxoles (CHEBI:38298) |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033959 | HMDB |
| Citations |
|---|