EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12ClN5O |
| Net Charge | 0 |
| Average Mass | 241.682 |
| Monoisotopic Mass | 241.07304 |
| SMILES | COc1nc(C)nc(Cl)c1NC1=NCCN1 |
| InChI | InChI=1S/C9H12ClN5O/c1-5-13-7(10)6(8(14-5)16-2)15-9-11-3-4-12-9/h3-4H2,1-2H3,(H2,11,12,15) |
| InChIKey | WPNJAUFVNXKLIM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. vasoconstrictor agent Drug used to cause constriction of the blood vessels. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Moxonidine (CHEBI:7009) has role antihypertensive agent (CHEBI:35674) |
| Moxonidine (CHEBI:7009) has role cardiovascular drug (CHEBI:35554) |
| Moxonidine (CHEBI:7009) has role vasoconstrictor agent (CHEBI:50514) |
| Moxonidine (CHEBI:7009) is a organohalogen compound (CHEBI:17792) |
| Moxonidine (CHEBI:7009) is a pyrimidines (CHEBI:39447) |
| INN | Source |
|---|---|
| moxonidina | WHO MedNet |
| Synonyms | Source |
|---|---|
| BDF-5896 | ChEMBL |
| BDF5896 | ChEMBL |
| BE-5895 | ChEMBL |
| BE5895 | ChEMBL |
| LY-326869 | ChEMBL |
| LY326869 | ChEMBL |
| Brand Names | Source |
|---|---|
| Cynt | ChEMBL |
| Fisiotens | ChEMBL |
| Normatens | ChEMBL |
| Physiotens | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1856 | DrugCentral |
| C07451 | KEGG COMPOUND |
| D05087 | KEGG DRUG |
| HMDB0041938 | HMDB |
| LSM-3743 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:75438-57-2 | KEGG COMPOUND |
| Citations |
|---|