EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26O5 |
| Net Charge | 0 |
| Average Mass | 358.434 |
| Monoisotopic Mass | 358.17802 |
| SMILES | COc1c(O)c2cc(c1OC)-c1cc(ccc1O)CC[C@@H](O)CCCC2 |
| InChI | InChI=1S/C21H26O5/c1-25-20-17-12-14(19(24)21(20)26-2)5-3-4-6-15(22)9-7-13-8-10-18(23)16(17)11-13/h8,10-12,15,22-24H,3-7,9H2,1-2H3/t15-/m0/s1 |
| InChIKey | SBGBAZQAEOWGFT-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myrica cerifera (ncbitaxon:3510) | root (BTO:0001188) | PubMed (21141876) | Previous component: root bark; Toluene extract of raw-bayberry root-bark powder |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-aR,11S-Myricanol (CHEBI:70081) has role metabolite (CHEBI:25212) |
| (+)-aR,11S-Myricanol (CHEBI:70081) is a biphenyls (CHEBI:22888) |
| Synonym | Source |
|---|---|
| (9S)-16,17-Dimethoxytricyclo[12.3.1.1(2,6)]nonadeca1(18),2(19),3,5,14,16-hexaene-3,9,15-triol | ChEBI |
| Citations |
|---|