EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O4 |
| Net Charge | 0 |
| Average Mass | 324.376 |
| Monoisotopic Mass | 324.13616 |
| SMILES | CC(C)=CCOc1ccc(C(=O)/C=C/c2ccc(O)cc2)c(O)c1 |
| InChI | InChI=1S/C20H20O4/c1-14(2)11-12-24-17-8-9-18(20(23)13-17)19(22)10-5-15-3-6-16(21)7-4-15/h3-11,13,21,23H,12H2,1-2H3/b10-5+ |
| InChIKey | SFXYAAFUXNWNQF-BJMVGYQFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lonchocarpus neuroscapha (IPNI:503039-1) | - | PubMed (21158427) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxycordoin (CHEBI:70080) has parent hydride trans-chalcone (CHEBI:48965) |
| 4-hydroxycordoin (CHEBI:70080) has role anti-inflammatory agent (CHEBI:67079) |
| 4-hydroxycordoin (CHEBI:70080) has role antibacterial agent (CHEBI:33282) |
| 4-hydroxycordoin (CHEBI:70080) has role plant metabolite (CHEBI:76924) |
| 4-hydroxycordoin (CHEBI:70080) is a aromatic ether (CHEBI:35618) |
| 4-hydroxycordoin (CHEBI:70080) is a chalcones (CHEBI:23086) |
| 4-hydroxycordoin (CHEBI:70080) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (2E)-1-{2-hydroxy-4-[(3-methylbut-2-en-1-yl)oxy]phenyl}-3-(4-hydroxyphenyl)prop-2-en-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2665335 | Reaxys |
| CAS:55524-25-9 | ChemIDplus |
| Citations |
|---|