EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24FN3O4.HCl |
| Net Charge | 0 |
| Average Mass | 437.899 |
| Monoisotopic Mass | 437.15176 |
| SMILES | Cl.[H][C@@]12CCCN[C@]1([H])CN(c1c(F)cc3c(=O)c(C(=O)O)cn(C4CC4)c3c1OC)C2 |
| InChI | InChI=1S/C21H24FN3O4.ClH/c1-29-20-17-13(19(26)14(21(27)28)9-25(17)12-4-5-12)7-15(22)18(20)24-8-11-3-2-6-23-16(11)10-24;/h7,9,11-12,16,23H,2-6,8,10H2,1H3,(H,27,28);1H/t11-,16+;/m0./s1 |
| InChIKey | IDIIJJHBXUESQI-DFIJPDEKSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| moxifloxacin hydrochloride (CHEBI:7008) has part moxifloxacinium(1+) (CHEBI:63699) |
| moxifloxacin hydrochloride (CHEBI:7008) has role antibacterial drug (CHEBI:36047) |
| moxifloxacin hydrochloride (CHEBI:7008) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-cyclopropyl-6-fluoro-8-methoxy-7-[(4aS,7aS)-octahydro-6H-pyrrolo[3,4-b]pyridin-6-yl]-4-oxo-1,4-dihydroquinoline-3-carboxylic acid hydrochloride |
| Synonyms | Source |
|---|---|
| 1-Cyclopropyl-6-fluoro-1,4-dihydro-8-methoxy-7-((4aS,7aS)-octahydro-6H-pyrrolo(3,4-b)pyridin-6-yl)-4-oxo-3-quinolinecarboxylic acid, monohydrochloride | ChemIDplus |
| (4aS-cis)-1-Cyclopropyl-6-fluoro-1,4-dihydro-8-methoxy-7-(octahydro-6H-pyrrolol(3,4-b)pyridin-6-yl)-4-oxo-3-quinolinecarboxylic acid, monohydrochloride | ChemIDplus |
| Moxifloxacin HCl | DrugBank |
| Brand Name | Source |
|---|---|
| Vigamox | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| C08054 | KEGG COMPOUND |
| D00874 | KEGG DRUG |
| DB00218 | DrugBank |
| US2010152229 | Patent |
| US2011212990 | Patent |
| WO2011121596 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8377447 | Reaxys |
| CAS:186826-86-8 | ChemIDplus |
| CAS:186826-86-8 | KEGG COMPOUND |
| Citations |
|---|