EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18O2 |
| Net Charge | 0 |
| Average Mass | 206.285 |
| Monoisotopic Mass | 206.13068 |
| SMILES | CC(C)=CCOc1ccc(CCO)cc1 |
| InChI | InChI=1S/C13H18O2/c1-11(2)8-10-15-13-5-3-12(4-6-13)7-9-14/h3-6,8,14H,7,9-10H2,1-2H3 |
| InChIKey | IBVFUNAQXWFZQB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stachylidium (ncbitaxon:796327) | - | PubMed (21162532) | Marine derived fungus isolated from sponge Callyspongia sp. cf. C. flammea Strain: 220 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Etrogol (CHEBI:70079) has role metabolite (CHEBI:25212) |
| Etrogol (CHEBI:70079) is a alcohol (CHEBI:30879) |
| Etrogol (CHEBI:70079) is a phenols (CHEBI:33853) |
| Synonym | Source |
|---|---|
| 2-(4-(3-methylbut-2-enyloxy)phenyl)ethanol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0039101 | HMDB |
| Citations |
|---|