EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18O3 |
| Net Charge | 0 |
| Average Mass | 222.284 |
| Monoisotopic Mass | 222.12559 |
| SMILES | C=C(C)[C@H](O)COc1ccc(CCO)cc1 |
| InChI | InChI=1S/C13H18O3/c1-10(2)13(15)9-16-12-5-3-11(4-6-12)7-8-14/h3-6,13-15H,1,7-9H2,2H3/t13-/m1/s1 |
| InChIKey | XOKNJGSBLIKARH-CYBMUJFWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stachylidium (ncbitaxon:796327) | - | PubMed (21162532) | Marine derived fungus isolated from sponge Callyspongia sp. cf. C. flammea Strain: 220 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Stachyline C (CHEBI:70077) has role metabolite (CHEBI:25212) |
| Stachyline C (CHEBI:70077) is a alcohol (CHEBI:30879) |
| Stachyline C (CHEBI:70077) is a phenols (CHEBI:33853) |
| Synonym | Source |
|---|---|
| (2S)-1-[4-(2-hydroxyethyl)phenoxy]-3-methylbut-3-en-2-ol | ChEBI |
| Citations |
|---|