EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O4 |
| Net Charge | 0 |
| Average Mass | 236.267 |
| Monoisotopic Mass | 236.10486 |
| SMILES | C=C(C)[C@H](O)COc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C13H16O4/c1-9(2)12(14)8-17-11-5-3-10(4-6-11)7-13(15)16/h3-6,12,14H,1,7-8H2,2H3,(H,15,16)/t12-/m1/s1 |
| InChIKey | NTVKQXXUTNSBBQ-GFCCVEGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stachylidium (ncbitaxon:796327) | - | PubMed (21162532) | Marine derived fungus isolated from sponge Callyspongia sp. cf. C. flammea Strain: 220 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Stachyline B (CHEBI:70076) has role metabolite (CHEBI:25212) |
| Stachyline B (CHEBI:70076) is a monocarboxylic acid (CHEBI:25384) |
| Synonym | Source |
|---|---|
| 2-[4-[(2S)-2-hydroxy-3-methylbut-3-enoxy]phenyl]acetic acid | ChEBI |
| Citations |
|---|