EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17NO3 |
| Net Charge | 0 |
| Average Mass | 235.283 |
| Monoisotopic Mass | 235.12084 |
| SMILES | C=C(C)[C@H](O)COc1ccc(CC=NO)cc1 |
| InChI | InChI=1S/C13H17NO3/c1-10(2)13(15)9-17-12-5-3-11(4-6-12)7-8-14-16/h3-6,8,13,15-16H,1,7,9H2,2H3/t13-/m1/s1 |
| InChIKey | RYDLTTLOGVZOMQ-CYBMUJFWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stachylidium (ncbitaxon:796327) | - | PubMed (21162532) | Fungus isolated from sponge Callyspongia sp.cf.C. flammea,Compound is mixture of E-/Z-isomers (1:1) Strain: 220 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Stachyline A, (E and Z)- (CHEBI:70075) has role metabolite (CHEBI:25212) |
| Stachyline A, (E and Z)- (CHEBI:70075) is a aldoxime (CHEBI:22307) |
| Stachyline A, (E and Z)- (CHEBI:70075) is a aromatic ether (CHEBI:35618) |
| Synonym | Source |
|---|---|
| (E/Z)-(2S)-1-[4-(2-hydroxyiminoethyl)phenoxy]-3-methylbut-3-en-2-ol | ChEBI |
| Citations |
|---|