EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N2O3 |
| Net Charge | 0 |
| Average Mass | 368.477 |
| Monoisotopic Mass | 368.20999 |
| SMILES | [H][C@@]12C[C@]([H])(/C(=C\OC)C(=O)OC)[C@@H](CC)CN1CCc1c2nc2ccccc12 |
| InChI | InChI=1S/C22H28N2O3/c1-4-14-12-24-10-9-16-15-7-5-6-8-19(15)23-21(16)20(24)11-17(14)18(13-26-2)22(25)27-3/h5-8,13-14,17,20,23H,4,9-12H2,1-3H3/b18-13+/t14-,17-,20-/m0/s1 |
| InChIKey | NMLUOJBSAYAYEM-XPOGPMDLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Uncaria macrophylla (ncbitaxon:714513) | aerial part (BTO:0001658) | PubMed (21070010) | Emulsion layer of methanolic extract of dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dihydrocorynantheine (CHEBI:70074) has role metabolite (CHEBI:25212) |
| Dihydrocorynantheine (CHEBI:70074) is a alkaloid (CHEBI:22315) |
| Synonyms | Source |
|---|---|
| 18,19-Dihydrocorynantheine | KEGG COMPOUND |
| hirsutine | ChEBI |
| methyl(E)-2-[(2S,3R,12bS)-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 0050439684 | ChemIDplus |
| C16953 | KEGG COMPOUND |
| C16972 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:50439-68-4 | KEGG COMPOUND |
| CAS:7729-23-9 | KEGG COMPOUND |
| Citations |
|---|