EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N2O4 |
| Net Charge | 0 |
| Average Mass | 384.476 |
| Monoisotopic Mass | 384.20491 |
| SMILES | [H][C@]1(/C(=C\OC)C(=O)OC)C[C@]2([H])N(CC[C@]23C(=O)Nc2ccccc23)C[C@@H]1CC |
| InChI | InChI=1S/C22H28N2O4/c1-4-14-12-24-10-9-22(17-7-5-6-8-18(17)23-21(22)26)19(24)11-15(14)16(13-27-2)20(25)28-3/h5-8,13-15,19H,4,9-12H2,1-3H3,(H,23,26)/b16-13+/t14-,15-,19-,22+/m0/s1 |
| InChIKey | DAXYUDFNWXHGBE-KAXDATADSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Uncaria macrophylla (ncbitaxon:714513) | aerial part (BTO:0001658) | PubMed (21070010) | Chloroform soluble fraction of methanolic extract of dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rhynchophylline (CHEBI:70069) has role metabolite (CHEBI:25212) |
| Rhynchophylline (CHEBI:70069) is a indolizines (CHEBI:38485) |
| Synonyms | Source |
|---|---|
| methyl(E)-2-[(3R,6'R,7'S,8'aS)-6'-ethyl-2-oxospiro[1H-indole-3,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-7'-yl]-3-methoxyprop-2-enoate | ChEBI |
| Mitrinermine | ChEBI |
| Rhynchophylline | KEGG COMPOUND |
| Citations |
|---|