EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32N2O5 |
| Net Charge | 0 |
| Average Mass | 440.540 |
| Monoisotopic Mass | 440.23112 |
| SMILES | [H][C@]1(/C(=C\OC)C(=O)OC)C[C@]2([H])N(CC[C@@]23C(=O)Nc2ccccc23)[C@@H](CC(C)=O)[C@@H]1CC |
| InChI | InChI=1S/C25H32N2O5/c1-5-16-17(18(14-31-3)23(29)32-4)13-22-25(10-11-27(22)21(16)12-15(2)28)19-8-6-7-9-20(19)26-24(25)30/h6-9,14,16-17,21-22H,5,10-13H2,1-4H3,(H,26,30)/b18-14+/t16-,17+,21+,22+,25+/m1/s1 |
| InChIKey | VWNYHBABHBBFQC-KEBVZHCUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Uncaria macrophylla (ncbitaxon:714513) | aerial part (BTO:0001658) | PubMed (21070010) | Chloroform soluble fraction of methanolic extract of dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Macrophylline B (CHEBI:70068) has role metabolite (CHEBI:25212) |
| Macrophylline B (CHEBI:70068) is a indolizines (CHEBI:38485) |
| Synonym | Source |
|---|---|
| methyl(Z)-2-[(3S,5'S,6'R,7'S,8'aS)-6'-ethyl-2-oxo-5'-(2-oxopropyl)spiro[1H-indole-3,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-7'-yl]-3-methoxyprop-2-enoate | ChEBI |
| Citations |
|---|