EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30N2O4 |
| Net Charge | 0 |
| Average Mass | 398.503 |
| Monoisotopic Mass | 398.22056 |
| SMILES | [H][C@]1(/C(=C\OC)C(=O)OC)C[C@]2([H])[C@]3(CC[N@+]2(C)C[C@@H]1CC)C([O-])=Nc1ccccc13 |
| InChI | InChI=1S/C23H30N2O4/c1-5-15-13-25(2)11-10-23(18-8-6-7-9-19(18)24-22(23)27)20(25)12-16(15)17(14-28-3)21(26)29-4/h6-9,14-16,20H,5,10-13H2,1-4H3/b17-14+/t15-,16-,20+,23+,25+/m0/s1 |
| InChIKey | QVNYBASBMONTJV-WHLUUPBTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Uncaria macrophylla (ncbitaxon:714513) | aerial part (BTO:0001658) | PubMed (21070010) | Emulsion layer of methanolic extract of dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Macrophyllionium (CHEBI:70066) has role metabolite (CHEBI:25212) |
| Macrophyllionium (CHEBI:70066) is a indolizines (CHEBI:38485) |
| Synonym | Source |
|---|---|
| (1R,4R,6R,7S,8aR)-7-[(Z)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]-6-ethyl-4-methylspiro[3,5,6,7,8,8a-hexahydro-2H-indolizin-4-ium1,3'-indole]-2'-olate | ChEBI |
| Citations |
|---|