EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H14O6 |
| Net Charge | 0 |
| Average Mass | 338.315 |
| Monoisotopic Mass | 338.07904 |
| SMILES | Cc1cc(O)c2c(c1)C[C@@H](O)C1=C2C(=O)c2c(O)ccc(O)c2C1=O |
| InChI | InChI=1S/C19H14O6/c1-7-4-8-6-12(23)16-17(13(8)11(22)5-7)19(25)15-10(21)3-2-9(20)14(15)18(16)24/h2-5,12,20-23H,6H2,1H3/t12-/m1/s1 |
| InChIKey | DMGKSWBAQZKXEJ-GFCCVEGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces cyanogenus (ncbitaxon:80860) | - | PubMed (21188999) | Ethyl acetate extract of broth Strain: S 136 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Landomycinone (CHEBI:70059) has role metabolite (CHEBI:25212) |
| Landomycinone (CHEBI:70059) is a anthraquinone (CHEBI:22580) |
| Synonym | Source |
|---|---|
| (6R)-1,6,8,11-Tetrahydroxy-3-methyl-5,6-dihydro-7,12-tetraphenedion | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 26387866 | ChemSpider |
| Citations |
|---|