EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H32O11 |
| Net Charge | 0 |
| Average Mass | 580.586 |
| Monoisotopic Mass | 580.19446 |
| SMILES | [H][C@]1(O[C@H]2C[C@@H](O)[C@H](O)[C@@H](C)O2)[C@H](O)C[C@H](Oc2ccc(O)c3c2C(=O)c2ccc4cc(C)cc(O)c4c2C3=O)O[C@@H]1C |
| InChI | InChI=1S/C31H32O11/c1-12-8-15-4-5-16-25(24(15)18(33)9-12)30(38)26-17(32)6-7-21(27(26)29(16)37)41-22-11-20(35)31(14(3)40-22)42-23-10-19(34)28(36)13(2)39-23/h4-9,13-14,19-20,22-23,28,31-36H,10-11H2,1-3H3/t13-,14-,19-,20-,22+,23+,28-,31-/m1/s1 |
| InChIKey | NIYADHCAUUYEPB-YWQDWRTKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces cyanogenus (ncbitaxon:80860) | - | PubMed (21188999) | Ethyl acetate extract of broth Strain: S 136 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Landomycin R (CHEBI:70051) has role metabolite (CHEBI:25212) |
| Landomycin R (CHEBI:70051) is a angucycline (CHEBI:48130) |
| Synonym | Source |
|---|---|
| 8-(beta-D-olivosyl-1,4-beta-D-olivosyl)-5,6-anhydrolandomycinone | ChEBI |
| Citations |
|---|