EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24O6 |
| Net Charge | 0 |
| Average Mass | 420.461 |
| Monoisotopic Mass | 420.15729 |
| SMILES | CC(C)=CCc1c(-c2ccc(O)cc2O)oc2c3c(cc(O)c2c1=O)OC(C)(C)C=C3 |
| InChI | InChI=1S/C25H24O6/c1-13(2)5-7-17-22(29)21-19(28)12-20-16(9-10-25(3,4)31-20)24(21)30-23(17)15-8-6-14(26)11-18(15)27/h5-6,8-12,26-28H,7H2,1-4H3 |
| InChIKey | XFFOMNJIDRDDLQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| morusin (CHEBI:7005) has role antineoplastic agent (CHEBI:35610) |
| morusin (CHEBI:7005) has role plant metabolite (CHEBI:76924) |
| morusin (CHEBI:7005) is a extended flavonoid (CHEBI:71037) |
| morusin (CHEBI:7005) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 2-(2,4-dihydroxyphenyl)-5-hydroxy-8,8-dimethyl-3-(3-methylbut-2-en-1-yl)-4H,8H-benzo[1,2-b:3,4-b']dipyran-4-one |
| Manual Xrefs | Databases |
|---|---|
| C00001070 | KNApSAcK |
| C10106 | KEGG COMPOUND |
| HMDB0036631 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1442330 | Reaxys |
| CAS:62596-29-6 | ChemIDplus |
| CAS:62596-29-6 | KEGG COMPOUND |
| Citations |
|---|