EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20O6 |
| Net Charge | 0 |
| Average Mass | 284.308 |
| Monoisotopic Mass | 284.12599 |
| SMILES | C[C@@H]1CC[C@H](O)/C=C/C(=O)O[C@H](C)[C@@H](O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C14H20O6/c1-9-3-4-11(15)5-7-14(18)20-10(2)12(16)6-8-13(17)19-9/h5-12,15-16H,3-4H2,1-2H3/b7-5+,8-6+/t9-,10-,11+,12+/m1/s1 |
| InChIKey | SSVNIYICRYPPEB-RVEWEFICSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria (ncbitaxon:37991) | mycelium (BTO:0001436) | PubMed (21226484) | Ethyl acetate extract of broth and mycelia, fungus isolated from an undefined dead wood Strain: BCC 4297 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Clonostachydiol (CHEBI:70049) has role metabolite (CHEBI:25212) |
| Clonostachydiol (CHEBI:70049) is a macrodiolide (CHEBI:145556) |
| Synonym | Source |
|---|---|
| (3E,5S,6R,9E,11S,14R)-5,11-dihydroxy-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,8-dione | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:147317-35-9 | ChemIDplus |
| Citations |
|---|