EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36O8 |
| Net Charge | 0 |
| Average Mass | 464.555 |
| Monoisotopic Mass | 464.24102 |
| SMILES | C=C[C@@]1(C)CCc2c3c(c(O)c(O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c2[C@H]1O)C(C)(C)CCC3 |
| InChI | InChI=1S/C25H36O8/c1-5-25(4)10-8-12-13-7-6-9-24(2,3)16(13)18(28)21(15(12)22(25)31)33-23-20(30)19(29)17(27)14(11-26)32-23/h5,14,17,19-20,22-23,26-31H,1,6-11H2,2-4H3/t14-,17-,19+,20-,22-,23-,25+/m1/s1 |
| InChIKey | GQECNZJTMLRIAM-DWRPHZCTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria (ncbitaxon:37991) | mycelium (BTO:0001436) | PubMed (21226484) | Ethyl acetate extract of broth and mycelia, fungus isolated from an undefined dead wood Strain: BCC 4297 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xylopimarane (CHEBI:70048) has role metabolite (CHEBI:25212) |
| Xylopimarane (CHEBI:70048) is a O-acyl carbohydrate (CHEBI:52782) |
| Synonym | Source |
|---|---|
| (7R,8S)-8,10-Dihydroxy-1,1,7-trimethyl-7-vinyl-1,2,3,4,5,6,7,8-octahydro-9-phenanthrenyl alpha-D-glucopyranoside | ChEBI |
| Citations |
|---|