EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O4 |
| Net Charge | 0 |
| Average Mass | 268.353 |
| Monoisotopic Mass | 268.16746 |
| SMILES | [H][C@]12[C@@H](O)C(=C)[C@]3(O)[C@@H](O)C[C@H](C)[C@@]([H])(CC[C@]1(C)O)[C@]23[H] |
| InChI | InChI=1S/C15H24O4/c1-7-6-10(16)15(19)8(2)13(17)12-11(15)9(7)4-5-14(12,3)18/h7,9-13,16-19H,2,4-6H2,1,3H3/t7-,9+,10-,11+,12-,13-,14-,15-/m0/s1 |
| InChIKey | VSYYGRVMIXLSHL-PSVDSPEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stereum (ncbitaxon:5644) | - | PubMed (21210711) | crude ethyl acetate extract Strain: CCTCC AF 207024 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Stereumin J (CHEBI:70047) has role metabolite (CHEBI:25212) |
| Stereumin J (CHEBI:70047) is a tertiary alcohol (CHEBI:26878) |
| Citations |
|---|