EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O |
| Net Charge | 0 |
| Average Mass | 296.454 |
| Monoisotopic Mass | 296.21402 |
| SMILES | [H][C@@]12CC[C@@]3(C=CC(=O)C=C3C)[C@@]1([H])CC[C@]1(C)[C@@H](C=C)CC[C@@]21[H] |
| InChI | InChI=1S/C21H28O/c1-4-15-5-6-18-17-8-12-21(11-7-16(22)13-14(21)2)19(17)9-10-20(15,18)3/h4,7,11,13,15,17-19H,1,5-6,8-10,12H2,2-3H3/t15-,17-,18-,19-,20+,21+/m0/s1 |
| InChIKey | WBURTZSEYTVSRX-OPJRWSFGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Carijoa (ncbitaxon:360971) | - | PubMed (21235217) | Acetone extract of fresh sample |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Carijodienone (CHEBI:70042) has role metabolite (CHEBI:25212) |
| Carijodienone (CHEBI:70042) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| (5R)-5,9-Cyclo-9,10-secopregna-1(10),3,20-trien-2-one | ChEBI |
| Citations |
|---|