EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H52O10 |
| Net Charge | 0 |
| Average Mass | 668.824 |
| Monoisotopic Mass | 668.35605 |
| SMILES | [H][C@]12[C@H](CCCCC)OC=C3[C@@]1(C(=O)[C@]1([H])O[C@@]14C[C@H](O)C(C)(C)O[C@@]34[H])[C@@H]1O[C@@H](CCCCC)[C@@]2([H])C2=C1[C@]1([H])OC(C)(C)[C@@H](O)C[C@@]13O[C@@]3([H])C2=O |
| InChI | InChI=1S/C38H52O10/c1-7-9-11-13-19-23-24-25(30-37(32(47-37)27(24)41)16-22(40)35(5,6)46-30)31(44-19)38-18(17-43-20(26(23)38)14-12-10-8-2)29-36(33(48-36)28(38)42)15-21(39)34(3,4)45-29/h17,19-23,26,29-33,39-40H,7-16H2,1-6H3/t19-,20-,21-,22-,23-,26+,29-,30-,31+,32-,33-,36+,37+,38+/m0/s1 |
| InChIKey | QOGRHXMXZZVQKH-BOABAKHZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pestalotiopsis (ncbitaxon:36460) | - | PubMed (21302965) | EtOAc extract of fermented endophytic fungi isolated from branches of Podocarpus macrophyllus |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pestaloquinol B (CHEBI:70041) has role metabolite (CHEBI:25212) |
| Pestaloquinol B (CHEBI:70041) is a organic heterotricyclic compound (CHEBI:26979) |
| Pestaloquinol B (CHEBI:70041) is a organooxygen compound (CHEBI:36963) |
| Citations |
|---|