EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O5 |
| Net Charge | 0 |
| Average Mass | 338.444 |
| Monoisotopic Mass | 338.20932 |
| SMILES | [H][C@@]12OC(C)(C)[C@@H](O)C[C@@]13O[C@@]3([H])[C@H](O)C(/C=C/CCCCC)=C2CO |
| InChI | InChI=1S/C19H30O5/c1-4-5-6-7-8-9-12-13(11-20)16-19(17(24-19)15(12)22)10-14(21)18(2,3)23-16/h8-9,14-17,20-22H,4-7,10-11H2,1-3H3/b9-8+/t14-,15+,16-,17-,19+/m0/s1 |
| InChIKey | BAJVQMTZYHWAMD-UDIPEWIUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eutypella scoparia (ncbitaxon:140560) | - | PubMed (21302965) | Fungus isolated from the marine pulmonate mollusc Onchidium sp. |
| Pestalotiopsis (ncbitaxon:36460) | - | PubMed (21302965) | EtOAc extract of fermented endophytic fungi isolated from branches of Podocarpus macrophyllus |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cytosporin D (CHEBI:70039) has role metabolite (CHEBI:25212) |
| Cytosporin D (CHEBI:70039) is a oxanes (CHEBI:46942) |
| Synonym | Source |
|---|---|
| (1aS,2R,4aS,7S,8aR)-3-[(1E)-1-Hepten-1-yl]-4-(hydroxymethyl)-6,6-dimethyl-2,4a,7,8-tetrahydro-1aH,6H-oxireno[e]chromene-2,7-diol | ChEBI |
| Citations |
|---|