EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56O |
| Net Charge | 0 |
| Average Mass | 552.887 |
| Monoisotopic Mass | 552.43312 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C(=O)[C@]2(C)CCCC2(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C40H56O/c1-31(19-13-21-33(3)24-26-36-35(5)23-15-28-38(36,6)7)17-11-12-18-32(2)20-14-22-34(4)25-27-37(41)40(10)30-16-29-39(40,8)9/h11-14,17-22,24-27H,15-16,23,28-30H2,1-10H3/b12-11+,19-13+,20-14+,26-24+,27-25+,31-17+,32-18+,33-21+,34-22+/t40-/m0/s1 |
| InChIKey | YWYZMPABROOXTM-BKGWKKLQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pouteria sapota (ncbitaxon:233744) | ripe fruit (PO:0007038) | PubMed (21214217) | Acetone extract of pulp of ripe fruit of red mamey |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sapotexanthin (CHEBI:70038) has role metabolite (CHEBI:25212) |
| Sapotexanthin (CHEBI:70038) is a xanthophyll (CHEBI:27325) |
| Synonyms | Source |
|---|---|
| (2E,4E,6E,8E,10E,12E,14E,16E,18E)-4,8,13,17-tetramethyl-19-(2,6,6-trimethylcyclohexen-1-yl)-1-[(1R)-1,2,2-trimethylcyclopentyl]nonadeca-2,4,6,8,10,12,14,16,18-nonaen-1-one | ChEBI |
| (all-E,5'R)-beta,kappa-caroten-6'-one | ChEBI |
| Citations |
|---|