EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O6 |
| Net Charge | 0 |
| Average Mass | 300.266 |
| Monoisotopic Mass | 300.06339 |
| SMILES | COc1cc(O)c2c(=O)c(-c3ccc(O)cc3O)coc2c1 |
| InChI | InChI=1S/C16H12O6/c1-21-9-5-13(19)15-14(6-9)22-7-11(16(15)20)10-3-2-8(17)4-12(10)18/h2-7,17-19H,1H3 |
| InChIKey | ALFNTRJPGFNJQV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crotalaria lachnophora (IPNI:488342-1) | whole plant (BTO:0001461) | PubMed (21265557) | Chloroform soluble fraction of CH2Cl2/MeOH (1:1) crude extract of dried and powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cajanin (CHEBI:70036) has role metabolite (CHEBI:25212) |
| Cajanin (CHEBI:70036) is a 7-methoxyisoflavones (CHEBI:140356) |
| Synonyms | Source |
|---|---|
| 3-(2,4-dihydroxyphenyl)-5-hydroxy-7-methoxychromen-4-one | ChEBI |
| 5,2',4'-Trihydroxy-7-methoxyisoflavone | ChEBI |
| Cajanin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00002512 | KNApSAcK |
| C10203 | KEGG COMPOUND |
| HMDB0032696 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:32884-36-9 | KEGG COMPOUND |
| Citations |
|---|