EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O6 |
| Net Charge | 0 |
| Average Mass | 316.309 |
| Monoisotopic Mass | 316.09469 |
| SMILES | COc1cc(O)c2c(c1)OC[C@H](c1ccc(O)cc1OC)C2=O |
| InChI | InChI=1S/C17H16O6/c1-21-10-6-13(19)16-15(7-10)23-8-12(17(16)20)11-4-3-9(18)5-14(11)22-2/h3-7,12,18-19H,8H2,1-2H3/t12-/m1/s1 |
| InChIKey | RYYWWFXWFMYKJM-GFCCVEGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crotalaria lachnophora (IPNI:488342-1) | whole plant (BTO:0001461) | PubMed (21265557) | Chloroform soluble fraction of CH2Cl2/MeOH (1:1) crude extract of dried and powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cajanol (CHEBI:70034) has functional parent (3S)-isoflavanone (CHEBI:85935) |
| cajanol (CHEBI:70034) has role plant metabolite (CHEBI:76924) |
| cajanol (CHEBI:70034) is a hydroxyisoflavanone (CHEBI:72739) |
| cajanol (CHEBI:70034) is a methoxyisoflavanone (CHEBI:72740) |
| IUPAC Name |
|---|
| (3S)-5-hydroxy-3-(4-hydroxy-2-methoxyphenyl)-7-methoxy-2,3-dihydro-4H-1-benzopyran-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21312882 | Reaxys |
| CAS:61020-70-0 | KEGG COMPOUND |
| CAS:61020-70-0 | ChemIDplus |
| Citations |
|---|