EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14O6 |
| Net Charge | 0 |
| Average Mass | 350.326 |
| Monoisotopic Mass | 350.07904 |
| SMILES | C=C(C)C1Cc2c(cc3oc4oc5cc(O)ccc5c4c(=O)c3c2O)O1 |
| InChI | InChI=1S/C20H14O6/c1-8(2)12-6-11-14(24-12)7-15-17(18(11)22)19(23)16-10-4-3-9(21)5-13(10)25-20(16)26-15/h3-5,7,12,21-22H,1,6H2,2H3 |
| InChIKey | UVJBSWKDLJKBCL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crotalaria lachnophora (IPNI:488342-1) | whole plant (BTO:0001461) | PubMed (21265557) | Chloroform soluble fraction of CH2Cl2/MeOH (1:1) crude extract of dried and powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lachnoisoflavones B (CHEBI:70029) has role metabolite (CHEBI:25212) |
| Lachnoisoflavones B (CHEBI:70029) is a isoflavanones (CHEBI:38741) |
| Synonym | Source |
|---|---|
| 4,8-dihydroxy-2-isopropenyl-2,3-dihydro-5H-[1]benzofuro[2,3-b]furo[3,2-g]chromen-5-one | ChEBI |
| Citations |
|---|