EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O6 |
| Net Charge | 0 |
| Average Mass | 352.342 |
| Monoisotopic Mass | 352.09469 |
| SMILES | C=C(C)C1Cc2c(O)cc3occ(-c4ccc(O)cc4O)c(=O)c3c2O1 |
| InChI | InChI=1S/C20H16O6/c1-9(2)16-6-12-15(23)7-17-18(20(12)26-16)19(24)13(8-25-17)11-4-3-10(21)5-14(11)22/h3-5,7-8,16,21-23H,1,6H2,2H3 |
| InChIKey | HHQAAUSMOBNXFL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crotalaria lachnophora (IPNI:488342-1) | whole plant (BTO:0001461) | PubMed (21265557) | Chloroform soluble fraction of CH2Cl2/MeOH (1:1) crude extract of dried and powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lachnoisoflavones A, (rac)- (CHEBI:70028) has role metabolite (CHEBI:25212) |
| Lachnoisoflavones A, (rac)- (CHEBI:70028) is a isoflavanones (CHEBI:38741) |
| Synonyms | Source |
|---|---|
| 8-(2,4-Dihydroxyphenyl)-4-hydroxy-2-isopropenyl-2,3-dihydro-9H-furo[2,3-f]chromen-9-one | ChEBI |
| rac-7,2',4'-trihydroxy-5''-isopropenyl-4'',5''-dihydrofurano[2'',3'':5,6] isoflavone | ChEBI |
| Citations |
|---|