EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H48O11 |
| Net Charge | 0 |
| Average Mass | 632.747 |
| Monoisotopic Mass | 632.31966 |
| SMILES | [H][C@@]12CC=C3CC=CC(=O)[C@]3(C)[C@@]1([H])C[C@@H](O)[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](CO)[C@@]1([H])CC(C)=C(CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)O1 |
| InChI | InChI=1S/C34H48O11/c1-16-11-24(44-31(42)20(16)15-43-32-30(41)29(40)28(39)25(14-36)45-32)19(13-35)22-10-9-21-18-8-7-17-5-4-6-26(37)33(17,2)23(18)12-27(38)34(21,22)3/h4,6-7,18-19,21-25,27-30,32,35-36,38-41H,5,8-15H2,1-3H3/t18-,19-,21-,22+,23-,24+,25+,27+,28+,29-,30+,32+,33-,34-/m0/s1 |
| InChIKey | LZMUHRZRHBVVTP-MHEOYVQJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Datura inoxia (ncbitaxon:4075) | |||
| flower (BTO:0000469) | PubMed (21280589) | Methanolic extract of dried, pulverized leaves | |
| leaf (BTO:0000713) | PubMed (21280589) | Methanolic extract of dried, pulverized leaves |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dinoxin B (CHEBI:70027) has role metabolite (CHEBI:25212) |
| Dinoxin B (CHEBI:70027) is a withanolide (CHEBI:74716) |
| Synonyms | Source |
|---|---|
| 12,21-dihydroxy-1-oxowitha-2,5,24-trienolide-27-O-beta-D-glucopyranoside | ChEBI |
| Ergosta-2,5,24-trien-26-oic acid, 27-(beta-Dglucopyranosyloxy)-12,21,22-trihydroxy-1-oxo, delta-lactone | ChEBI |
| Citations |
|---|