EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24O8 |
| Net Charge | 0 |
| Average Mass | 452.459 |
| Monoisotopic Mass | 452.14712 |
| SMILES | C/C(=C/Cc1c(-c2cc(O)c(O)cc2O)oc2c3c(cc(O)c2c1=O)OC(C)(C)C=C3)CO |
| InChI | InChI=1S/C25H24O8/c1-12(11-26)4-5-14-22(31)21-19(30)10-20-13(6-7-25(2,3)33-20)24(21)32-23(14)15-8-17(28)18(29)9-16(15)27/h4,6-10,26-30H,5,11H2,1-3H3/b12-4- |
| InChIKey | UTYRRYOOGHLXNT-QCDXTXTGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artocarpus odoratissimus (ncbitaxon:709058) | - | PubMed (21275386) | Methanol-Dichloromethane (1:1) extract of dried, ground plant material |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxy-3-(4-hydroxy-3-methyl-but-2-enyl)-8,8-dimethyl-2-(2,4,5-trihydroxy-phenyl)-8H-pyrano[2,3-f]chromen-4-one (CHEBI:70026) has role plant metabolite (CHEBI:76924) |
| 5-hydroxy-3-(4-hydroxy-3-methyl-but-2-enyl)-8,8-dimethyl-2-(2,4,5-trihydroxy-phenyl)-8H-pyrano[2,3-f]chromen-4-one (CHEBI:70026) is a extended flavonoid (CHEBI:71037) |
| 5-hydroxy-3-(4-hydroxy-3-methyl-but-2-enyl)-8,8-dimethyl-2-(2,4,5-trihydroxy-phenyl)-8H-pyrano[2,3-f]chromen-4-one (CHEBI:70026) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| 5-hydroxy-3-[(2Z)-4-hydroxy-3-methylbut-2-en-1-yl]-8,8-dimethyl-2-(2,4,5-trihydroxyphenyl)-4H,8H-benzo[1,2-b:3,4-b']dipyran-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:26277670 | Reaxys |
| Citations |
|---|