EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O7 |
| Net Charge | 0 |
| Average Mass | 344.319 |
| Monoisotopic Mass | 344.08960 |
| SMILES | COc1cc(O)c2c(=O)c(O)c(-c3ccc(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C18H16O7/c1-22-10-7-11(19)15-14(8-10)25-18(17(21)16(15)20)9-4-5-12(23-2)13(6-9)24-3/h4-8,19,21H,1-3H3 |
| InChIKey | OEEUHNAUMMATJT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euodia confusa (IPNI:772960-1) | - | PubMed (21275386) | MeOH-CH2Cl2(1:1)extract of dried, ground plant material,synonym Euodia is captured instead of Evodia |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quercetin 7,3',4'-trimethyl ether (CHEBI:70024) has functional parent quercetin (CHEBI:16243) |
| quercetin 7,3',4'-trimethyl ether (CHEBI:70024) has role metabolite (CHEBI:25212) |
| quercetin 7,3',4'-trimethyl ether (CHEBI:70024) has role plant metabolite (CHEBI:76924) |
| quercetin 7,3',4'-trimethyl ether (CHEBI:70024) is a 3'-methoxyflavones (CHEBI:138730) |
| quercetin 7,3',4'-trimethyl ether (CHEBI:70024) is a dihydroxyflavone (CHEBI:38686) |
| quercetin 7,3',4'-trimethyl ether (CHEBI:70024) is a flavonols (CHEBI:28802) |
| quercetin 7,3',4'-trimethyl ether (CHEBI:70024) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 2-(3,4-dimethoxyphenyl)-3,5-dihydroxy-7-methoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2-(3,4-dimethoxyphenyl)-3,5-dihydroxy-7-methoxy-4H-1-Benzopyran-4-one | ChemIDplus |
| 3',4',7-trimethylquercetin | ChemIDplus |
| 3,5-dihydroxy-7,3',4'-trimethoxyflavone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:51422 | Reaxys |
| CAS:6068-80-0 | ChemIDplus |
| Citations |
|---|