EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O7 |
| Net Charge | 0 |
| Average Mass | 344.319 |
| Monoisotopic Mass | 344.08960 |
| SMILES | COc1cc(O)c2c(=O)c(O)c(-c3ccc(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C18H16O7/c1-22-10-7-11(19)15-14(8-10)25-18(17(21)16(15)20)9-4-5-12(23-2)13(6-9)24-3/h4-8,19,21H,1-3H3 |
| InChIKey | OEEUHNAUMMATJT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euodia confusa (IPNI:772960-1) | - | PubMed (21275386) | MeOH-CH2Cl2(1:1)extract of dried, ground plant material,synonym Euodia is captured instead of Evodia |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quercetin 7,3',4'-trimethyl ether (CHEBI:70024) has functional parent quercetin (CHEBI:16243) |
| quercetin 7,3',4'-trimethyl ether (CHEBI:70024) has role metabolite (CHEBI:25212) |
| quercetin 7,3',4'-trimethyl ether (CHEBI:70024) has role plant metabolite (CHEBI:76924) |
| quercetin 7,3',4'-trimethyl ether (CHEBI:70024) is a 3'-methoxyflavones (CHEBI:138730) |
| quercetin 7,3',4'-trimethyl ether (CHEBI:70024) is a dihydroxyflavone (CHEBI:38686) |
| quercetin 7,3',4'-trimethyl ether (CHEBI:70024) is a flavonols (CHEBI:28802) |
| quercetin 7,3',4'-trimethyl ether (CHEBI:70024) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 2-(3,4-dimethoxyphenyl)-3,5-dihydroxy-7-methoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2-(3,4-dimethoxyphenyl)-3,5-dihydroxy-7-methoxy-4H-1-Benzopyran-4-one | ChemIDplus |
| 3',4',7-trimethylquercetin | ChemIDplus |
| 3,5-dihydroxy-7,3',4'-trimethoxyflavone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:51422 | Reaxys |
| CAS:6068-80-0 | ChemIDplus |
| Citations |
|---|