EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O5 |
| Net Charge | 0 |
| Average Mass | 408.494 |
| Monoisotopic Mass | 408.19367 |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c(O)cc(O)c2c1O[C@H](c1ccc(O)cc1)CC2=O |
| InChI | InChI=1S/C25H28O5/c1-15(2)5-4-6-16(3)7-12-19-20(27)13-21(28)24-22(29)14-23(30-25(19)24)17-8-10-18(26)11-9-17/h5,7-11,13,23,26-28H,4,6,12,14H2,1-3H3/b16-7+/t23-/m0/s1 |
| InChIKey | GOAUTULGLLBZSR-YLLUOSTHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macaranga bicolor (ncbitaxon:396452) | - | PubMed (21275386) | Methanol-Dichloromethane (1:1) extract of dried, ground plant material |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sophoraflavanone A (CHEBI:70023) has functional parent (S)-naringenin (CHEBI:17846) |
| sophoraflavanone A (CHEBI:70023) has role antibacterial agent (CHEBI:33282) |
| sophoraflavanone A (CHEBI:70023) has role antineoplastic agent (CHEBI:35610) |
| sophoraflavanone A (CHEBI:70023) has role metabolite (CHEBI:25212) |
| sophoraflavanone A (CHEBI:70023) is a (2S)-flavan-4-one (CHEBI:140377) |
| sophoraflavanone A (CHEBI:70023) is a 4'-hydroxyflavanones (CHEBI:140331) |
| sophoraflavanone A (CHEBI:70023) is a trihydroxyflavanone (CHEBI:38739) |
| IUPAC Name |
|---|
| (2S)-8-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| 8-geranylnaringenin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12140286 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5641290 | Reaxys |
| Citations |
|---|