EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O5 |
| Net Charge | 0 |
| Average Mass | 408.494 |
| Monoisotopic Mass | 408.19367 |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c(O)cc(O)c2c1O[C@H](c1ccc(O)cc1)CC2=O |
| InChI | InChI=1S/C25H28O5/c1-15(2)5-4-6-16(3)7-12-19-20(27)13-21(28)24-22(29)14-23(30-25(19)24)17-8-10-18(26)11-9-17/h5,7-11,13,23,26-28H,4,6,12,14H2,1-3H3/b16-7+/t23-/m0/s1 |
| InChIKey | GOAUTULGLLBZSR-YLLUOSTHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macaranga bicolor (ncbitaxon:396452) | - | PubMed (21275386) | Methanol-Dichloromethane (1:1) extract of dried, ground plant material |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sophoraflavanone A (CHEBI:70023) has functional parent (S)-naringenin (CHEBI:17846) |
| sophoraflavanone A (CHEBI:70023) has role antibacterial agent (CHEBI:33282) |
| sophoraflavanone A (CHEBI:70023) has role antineoplastic agent (CHEBI:35610) |
| sophoraflavanone A (CHEBI:70023) has role metabolite (CHEBI:25212) |
| sophoraflavanone A (CHEBI:70023) is a (2S)-flavan-4-one (CHEBI:140377) |
| sophoraflavanone A (CHEBI:70023) is a 4'-hydroxyflavanones (CHEBI:140331) |
| sophoraflavanone A (CHEBI:70023) is a trihydroxyflavanone (CHEBI:38739) |
| IUPAC Name |
|---|
| (2S)-8-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| 8-geranylnaringenin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12140286 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5641290 | Reaxys |
| Citations |
|---|